C23H23F5N2O — CID 56643300
[(4aR,8aS)-1-[(3,5-difluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 56643300) has the molecular formula C23H23F5N2O and a molecular weight of 438.44 g/mol. Its IUPAC name is [(4aR,8aS)-1-[(3,5-difluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4aR,8aS)-1-[(3,5-difluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 56643300 |
| Molecular Formula | C23H23F5N2O |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [(4aR,8aS)-1-[(3,5-difluorophenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CC[C@H]2[C@H](CCCN2Cc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C23H23F5N2O/c24-19-9-15(10-20(25)12-19)13-29-7-2-4-17-14-30(8-6-21(17)29)22(31)16-3-1-5-18(11-16)23(26,27)28/h1,3,5,9-12,17,21H,2,4,6-8,13-14H2/t17-,21+/m1/s1 |
| InChIKey | PRGVLEMQVOBMDU-UTKZUKDTSA-N |
| XLogP | 5.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |