C27H31FN2O2 — CID 26278432
[(4aR,8aS)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone (PubChem CID 26278432) has the molecular formula C27H31FN2O2 and a molecular weight of 434.56 g/mol. Its IUPAC name is [(4aR,8aS)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(4aR,8aS)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 26278432 |
| Molecular Formula | C27H31FN2O2 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | [(4aR,8aS)-1-[[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-(4-fluorophenyl)methanone |
| SMILES | CC(C)(O)C#Cc1ccc(CN2CCC[C@@H]3CN(C(=O)c4ccc(F)cc4)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C27H31FN2O2/c1-27(2,32)15-13-20-5-7-21(8-6-20)18-29-16-3-4-23-19-30(17-14-25(23)29)26(31)22-9-11-24(28)12-10-22/h5-12,23,25,32H,3-4,14,16-19H2,1-2H3/t23-,25+/m1/s1 |
| InChIKey | GVDGUSROAIFXNY-NOZRDPDXSA-N |
| XLogP | 4.07 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|