C21H24FN3O — CID 29208188
(4aR,8aS)-6-[(4-fluorophenyl)methyl]-1-(pyridin-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 29208188) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is (4aR,8aS)-6-[(4-fluorophenyl)methyl]-1-(pyridin-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-[(4-fluorophenyl)methyl]-1-(pyridin-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 29208188 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (4aR,8aS)-6-[(4-fluorophenyl)methyl]-1-(pyridin-2-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CN(Cc3ccc(F)cc3)CC[C@@H]2N1Cc1ccccn1 |
| InChI | InChI=1S/C21H24FN3O/c22-18-7-4-16(5-8-18)13-24-12-10-20-17(14-24)6-9-21(26)25(20)15-19-3-1-2-11-23-19/h1-5,7-8,11,17,20H,6,9-10,12-15H2/t17-,20+/m1/s1 |
| InChIKey | AGPXAEBTOYXFSS-XLIONFOSSA-N |
| XLogP | 3.23 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |