C21H32Cl2FN3O — CID 154885326
(4aS,8aR)-6-[(4-fluorophenyl)methyl]-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride (PubChem CID 154885326) has the molecular formula C21H32Cl2FN3O and a molecular weight of 432.41 g/mol. Its IUPAC name is (4aS,8aR)-6-[(4-fluorophenyl)methyl]-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride.
| Compound Name | (4aS,8aR)-6-[(4-fluorophenyl)methyl]-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 154885326 |
| Molecular Formula | C21H32Cl2FN3O |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (4aS,8aR)-6-[(4-fluorophenyl)methyl]-1-(piperidin-4-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1CC[C@H]2CN(Cc3ccc(F)cc3)CC[C@H]2N1CC1CCNCC1 |
| InChI | InChI=1S/C21H30FN3O.2ClH/c22-19-4-1-16(2-5-19)13-24-12-9-20-18(15-24)3-6-21(26)25(20)14-17-7-10-23-11-8-17;;/h1-2,4-5,17-18,20,23H,3,6-15H2;2*1H/t18-,20+;;/m0../s1 |
| InChIKey | TXWWELCBHQOAOW-DJFAPTBBSA-N |
| XLogP | 3.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |