C24H32N4O — CID 118755628
(4aR,8aS)-1-(cyclohexylmethyl)-6-(quinoxalin-5-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 118755628) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is (4aR,8aS)-1-(cyclohexylmethyl)-6-(quinoxalin-5-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(cyclohexylmethyl)-6-(quinoxalin-5-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 118755628 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (4aR,8aS)-1-(cyclohexylmethyl)-6-(quinoxalin-5-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CN(Cc3cccc4nccnc34)CC[C@@H]2N1CC1CCCCC1 |
| InChI | InChI=1S/C24H32N4O/c29-23-10-9-19-16-27(17-20-7-4-8-21-24(20)26-13-12-25-21)14-11-22(19)28(23)15-18-5-2-1-3-6-18/h4,7-8,12-13,18-19,22H,1-3,5-6,9-11,14-17H2/t19-,22+/m1/s1 |
| InChIKey | JYLCGORIEUUALH-KNQAVFIVSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |