C22H23N5 — CID 95728190
5-[[(3S)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]quinoxaline (PubChem CID 95728190) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 5-[[(3S)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]quinoxaline.
| Compound Name | 5-[[(3S)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]quinoxaline |
|---|---|
| PubChem CID | 95728190 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 5-[[(3S)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]quinoxaline |
| SMILES | c1ccc2[nH]c(C[C@@H]3CCCN(Cc4cccc5nccnc45)C3)nc2c1 |
| InChI | InChI=1S/C22H23N5/c1-2-8-19-18(7-1)25-21(26-19)13-16-5-4-12-27(14-16)15-17-6-3-9-20-22(17)24-11-10-23-20/h1-3,6-11,16H,4-5,12-15H2,(H,25,26)/t16-/m0/s1 |
| InChIKey | LIDILUUWTVWVBW-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |