C24H28N4O — CID 93242474
1-[4-[[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]pyrrolidin-2-one (PubChem CID 93242474) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-[4-[[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 93242474 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-[4-[[(3R)-3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(CN2CCC[C@H](Cc3nc4ccccc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C24H28N4O/c29-24-8-4-14-28(24)20-11-9-18(10-12-20)16-27-13-3-5-19(17-27)15-23-25-21-6-1-2-7-22(21)26-23/h1-2,6-7,9-12,19H,3-5,8,13-17H2,(H,25,26)/t19-/m1/s1 |
| InChIKey | FLHDZOKGIBRZEL-LJQANCHMSA-N |
| XLogP | 4.14 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |