C18H22ClN5 — CID 91837439
2-[[1-[2-(4-chloropyrazol-1-yl)ethyl]piperidin-3-yl]methyl]-1H-benzimidazole (PubChem CID 91837439) has the molecular formula C18H22ClN5 and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-[[1-[2-(4-chloropyrazol-1-yl)ethyl]piperidin-3-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[1-[2-(4-chloropyrazol-1-yl)ethyl]piperidin-3-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 91837439 |
| Molecular Formula | C18H22ClN5 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[[1-[2-(4-chloropyrazol-1-yl)ethyl]piperidin-3-yl]methyl]-1H-benzimidazole |
| SMILES | Clc1cnn(CCN2CCCC(Cc3nc4ccccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C18H22ClN5/c19-15-11-20-24(13-15)9-8-23-7-3-4-14(12-23)10-18-21-16-5-1-2-6-17(16)22-18/h1-2,5-6,11,13-14H,3-4,7-10,12H2,(H,21,22) |
| InChIKey | KSBCPIVOILVSEA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |