C22H28N4 — CID 56900334
2-[3-[[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]ethanamine (PubChem CID 56900334) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[3-[[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]ethanamine.
| Compound Name | 2-[3-[[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]ethanamine |
|---|---|
| PubChem CID | 56900334 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[3-[[3-(1H-benzimidazol-2-ylmethyl)piperidin-1-yl]methyl]phenyl]ethanamine |
| SMILES | NCCc1cccc(CN2CCCC(Cc3nc4ccccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C22H28N4/c23-11-10-17-5-3-6-18(13-17)15-26-12-4-7-19(16-26)14-22-24-20-8-1-2-9-21(20)25-22/h1-3,5-6,8-9,13,19H,4,7,10-12,14-16,23H2,(H,24,25) |
| InChIKey | GCMAUOMMBFGCJE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |