C12H13F3KNO — CID 143698382
potassium 4-[3-(trifluoromethyl)phenyl]piperidin-1-id-4-ol (PubChem CID 143698382) has the molecular formula C12H13F3KNO and a molecular weight of 283.33 g/mol. Its IUPAC name is potassium 4-[3-(trifluoromethyl)phenyl]piperidin-1-id-4-ol.
| Compound Name | potassium 4-[3-(trifluoromethyl)phenyl]piperidin-1-id-4-ol |
|---|---|
| PubChem CID | 143698382 |
| Molecular Formula | C12H13F3KNO |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | potassium 4-[3-(trifluoromethyl)phenyl]piperidin-1-id-4-ol |
| SMILES | OC1(c2cccc(C(F)(F)F)c2)CC[N-]CC1.[K+] |
| InChI | InChI=1S/C12H13F3NO.K/c13-12(14,15)10-3-1-2-9(8-10)11(17)4-6-16-7-5-11;/h1-3,8,17H,4-7H2;/q-1;+1 |
| InChIKey | HUVJAERVWXYYSH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |