C15H20ClNO3 — CID 10827897
[4-(3-chlorophenyl)-1-methylpiperidin-4-yl] ethyl carbonate (PubChem CID 10827897) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is [4-(3-chlorophenyl)-1-methylpiperidin-4-yl] ethyl carbonate.
| Compound Name | [4-(3-chlorophenyl)-1-methylpiperidin-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 10827897 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [4-(3-chlorophenyl)-1-methylpiperidin-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1(c2cccc(Cl)c2)CCN(C)CC1 |
| InChI | InChI=1S/C15H20ClNO3/c1-3-19-14(18)20-15(7-9-17(2)10-8-15)12-5-4-6-13(16)11-12/h4-6,11H,3,7-10H2,1-2H3 |
| InChIKey | QQWYPWQRDLXGSO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |