C19H22ClFN2O3S — CID 134018579
1-(4-chlorophenyl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol (PubChem CID 134018579) has the molecular formula C19H22ClFN2O3S and a molecular weight of 412.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol.
| Compound Name | 1-(4-chlorophenyl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 134018579 |
| Molecular Formula | C19H22ClFN2O3S |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCCN(CC(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H22ClFN2O3S/c20-16-4-2-15(3-5-16)19(24)14-22-10-1-11-23(13-12-22)27(25,26)18-8-6-17(21)7-9-18/h2-9,19,24H,1,10-14H2 |
| InChIKey | MLJHDXVDWSGAPU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |