C17H17Cl2FN2O4S2 — CID 26544769
1-(3,5-dichlorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonyl-1,4-diazepane (PubChem CID 26544769) has the molecular formula C17H17Cl2FN2O4S2 and a molecular weight of 467.37 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(3,5-dichlorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 26544769 |
| Molecular Formula | C17H17Cl2FN2O4S2 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 1-(3,5-dichlorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCCN(S(=O)(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H17Cl2FN2O4S2/c18-13-10-14(19)12-17(11-13)28(25,26)22-7-1-6-21(8-9-22)27(23,24)16-4-2-15(20)3-5-16/h2-5,10-12H,1,6-9H2 |
| InChIKey | WTAJHZUYTXYSMW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |