C14H19ClN2OS — CID 67083410
1-(1-benzothiophen-3-yl)-2-piperazin-1-ylethanol;hydrochloride (PubChem CID 67083410) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-2-piperazin-1-ylethanol;hydrochloride.
| Compound Name | 1-(1-benzothiophen-3-yl)-2-piperazin-1-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 67083410 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-2-piperazin-1-ylethanol;hydrochloride |
| SMILES | Cl.OC(CN1CCNCC1)c1csc2ccccc12 |
| InChI | InChI=1S/C14H18N2OS.ClH/c17-13(9-16-7-5-15-6-8-16)12-10-18-14-4-2-1-3-11(12)14;/h1-4,10,13,15,17H,5-9H2;1H |
| InChIKey | AWXFNNJXDBUKJT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |