C17H24Cl2N2S — CID 171277623
1-[(1S)-1-(1-benzothiophen-3-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride (PubChem CID 171277623) has the molecular formula C17H24Cl2N2S and a molecular weight of 359.37 g/mol. Its IUPAC name is 1-[(1S)-1-(1-benzothiophen-3-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(1-benzothiophen-3-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277623 |
| Molecular Formula | C17H24Cl2N2S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-[(1S)-1-(1-benzothiophen-3-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@@H](c1csc2ccccc12)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H22N2S.2ClH/c1-13(2)11-16(19-9-7-18-8-10-19)15-12-20-17-6-4-3-5-14(15)17;;/h3-6,12,16,18H,1,7-11H2,2H3;2*1H/t16-;;/m0../s1 |
| InChIKey | MQDZMAJSYWYYRO-SQKCAUCHSA-N |
| XLogP | 4.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|