C17H28Cl2N2 — CID 171288458
1-[(1R)-1-(2,3-dimethylphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride (PubChem CID 171288458) has the molecular formula C17H28Cl2N2 and a molecular weight of 331.33 g/mol. Its IUPAC name is 1-[(1R)-1-(2,3-dimethylphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,3-dimethylphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171288458 |
| Molecular Formula | C17H28Cl2N2 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[(1R)-1-(2,3-dimethylphenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@H](c1cccc(C)c1C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H26N2.2ClH/c1-13(2)12-17(19-10-8-18-9-11-19)16-7-5-6-14(3)15(16)4;;/h5-7,17-18H,1,8-12H2,2-4H3;2*1H/t17-;;/m1../s1 |
| InChIKey | AGGIQIICHCFAAH-ZEECNFPPSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|