C16H24Cl2N2O2 — CID 171294860
1-[(1R)-1-(1,3-benzodioxol-4-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride (PubChem CID 171294860) has the molecular formula C16H24Cl2N2O2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 1-[(1R)-1-(1,3-benzodioxol-4-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(1,3-benzodioxol-4-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171294860 |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[(1R)-1-(1,3-benzodioxol-4-yl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@H](c1cccc2c1OCO2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H22N2O2.2ClH/c1-12(2)10-14(18-8-6-17-7-9-18)13-4-3-5-15-16(13)20-11-19-15;;/h3-5,14,17H,1,6-11H2,2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | DDBHSJAUUKZULO-FMOMHUKBSA-N |
| XLogP | 3.17 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|