C15H24Cl2N2O2 — CID 171294850
1-[(1R)-1-(1,3-benzodioxol-4-yl)butyl]piperazine;dihydrochloride (PubChem CID 171294850) has the molecular formula C15H24Cl2N2O2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 1-[(1R)-1-(1,3-benzodioxol-4-yl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(1,3-benzodioxol-4-yl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171294850 |
| Molecular Formula | C15H24Cl2N2O2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 1-[(1R)-1-(1,3-benzodioxol-4-yl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1cccc2c1OCO2)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H22N2O2.2ClH/c1-2-4-13(17-9-7-16-8-10-17)12-5-3-6-14-15(12)19-11-18-14;;/h3,5-6,13,16H,2,4,7-11H2,1H3;2*1H/t13-;;/m1../s1 |
| InChIKey | JASVTETUNGGAHY-FFXKMJQXSA-N |
| XLogP | 3.01 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |