C15H20BrFN2 — CID 171289876
1-[(1R)-1-(2-bromo-3-fluorophenyl)-3-methylbut-3-enyl]piperazine (PubChem CID 171289876) has the molecular formula C15H20BrFN2 and a molecular weight of 327.24 g/mol. Its IUPAC name is 1-[(1R)-1-(2-bromo-3-fluorophenyl)-3-methylbut-3-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(2-bromo-3-fluorophenyl)-3-methylbut-3-enyl]piperazine |
|---|---|
| PubChem CID | 171289876 |
| Molecular Formula | C15H20BrFN2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-[(1R)-1-(2-bromo-3-fluorophenyl)-3-methylbut-3-enyl]piperazine |
| SMILES | C=C(C)C[C@H](c1cccc(F)c1Br)N1CCNCC1 |
| InChI | InChI=1S/C15H20BrFN2/c1-11(2)10-14(19-8-6-18-7-9-19)12-4-3-5-13(17)15(12)16/h3-5,14,18H,1,6-10H2,2H3/t14-/m1/s1 |
| InChIKey | CDFFTJPSBWLSMM-CQSZACIVSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|