C17H21ClN2OS — CID 87261853
2-(1-benzothiophen-3-yl)-3-methyl-4-piperazin-1-ylbut-1-en-1-one;hydrochloride (PubChem CID 87261853) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-3-methyl-4-piperazin-1-ylbut-1-en-1-one;hydrochloride.
| Compound Name | 2-(1-benzothiophen-3-yl)-3-methyl-4-piperazin-1-ylbut-1-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 87261853 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-3-methyl-4-piperazin-1-ylbut-1-en-1-one;hydrochloride |
| SMILES | CC(CN1CCNCC1)C(=C=O)c1csc2ccccc12.Cl |
| InChI | InChI=1S/C17H20N2OS.ClH/c1-13(10-19-8-6-18-7-9-19)15(11-20)16-12-21-17-5-3-2-4-14(16)17;/h2-5,12-13,18H,6-10H2,1H3;1H |
| InChIKey | GXOWTANBDHLVPQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|