C28H35ClN2OS — CID 87261846
2-(1-benzothiophen-3-yl)-3-[[4-(2-phenylethyl)piperazin-1-yl]methyl]hept-1-en-1-one;hydrochloride (PubChem CID 87261846) has the molecular formula C28H35ClN2OS and a molecular weight of 483.12 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-3-[[4-(2-phenylethyl)piperazin-1-yl]methyl]hept-1-en-1-one;hydrochloride.
| Compound Name | 2-(1-benzothiophen-3-yl)-3-[[4-(2-phenylethyl)piperazin-1-yl]methyl]hept-1-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 87261846 |
| Molecular Formula | C28H35ClN2OS |
| Molecular Weight | 483.12 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-3-[[4-(2-phenylethyl)piperazin-1-yl]methyl]hept-1-en-1-one;hydrochloride |
| SMILES | CCCCC(CN1CCN(CCc2ccccc2)CC1)C(=C=O)c1csc2ccccc12.Cl |
| InChI | InChI=1S/C28H34N2OS.ClH/c1-2-3-11-24(26(21-31)27-22-32-28-13-8-7-12-25(27)28)20-30-18-16-29(17-19-30)15-14-23-9-5-4-6-10-23;/h4-10,12-13,22,24H,2-3,11,14-20H2,1H3;1H |
| InChIKey | DLPKHRLMOKMCBK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.12 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|