C19H19NOS — CID 112826472
N-methyl-N-(3-phenylpropyl)-1-benzothiophene-3-carboxamide (PubChem CID 112826472) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is N-methyl-N-(3-phenylpropyl)-1-benzothiophene-3-carboxamide.
| Compound Name | N-methyl-N-(3-phenylpropyl)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 112826472 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-methyl-N-(3-phenylpropyl)-1-benzothiophene-3-carboxamide |
| SMILES | CN(CCCc1ccccc1)C(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C19H19NOS/c1-20(13-7-10-15-8-3-2-4-9-15)19(21)17-14-22-18-12-6-5-11-16(17)18/h2-6,8-9,11-12,14H,7,10,13H2,1H3 |
| InChIKey | PCUBAQZFUYYRIZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |