About N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide
N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide (PubChem CID 122151930) has the molecular formula C15H19NO2S
and a molecular weight of 277.39 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide |
| PubChem CID | 122151930 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide |
| SMILES | CN(CC(C)(C)CO)C(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C15H19NO2S/c1-15(2,10-17)9-16(3)14(18)12-8-19-13-7-5-4-6-11(12)13/h4-8,17H,9-10H2,1-3H3 |
| InChIKey | IZVFIPXGZCVPKE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide?
The IUPAC name of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide (CID 122151930) is N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide.
What is the SMILES notation for N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide?
The canonical SMILES for N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide is CN(CC(C)(C)CO)C(=O)c1csc2ccccc12.
What is the InChIKey of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide?
The InChIKey is IZVFIPXGZCVPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2S/c1-15(2,10-17)9-16(3)14(18)12-8-19-13-7-5-4-6-11(12)13/h4-8,17H,9-10H2,1-3H3.
What are the key properties of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide?
N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide has a molecular weight of 277.39 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-1-benzothiophene-3-carboxamide is sourced from PubChem (CID 122151930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).