C20H33N3O — CID 52553124
2-[4-(2-phenylethyl)piperazin-1-yl]-N,N-dipropylacetamide (PubChem CID 52553124) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-[4-(2-phenylethyl)piperazin-1-yl]-N,N-dipropylacetamide.
| Compound Name | 2-[4-(2-phenylethyl)piperazin-1-yl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 52553124 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 2-[4-(2-phenylethyl)piperazin-1-yl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CN1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H33N3O/c1-3-11-23(12-4-2)20(24)18-22-16-14-21(15-17-22)13-10-19-8-6-5-7-9-19/h5-9H,3-4,10-18H2,1-2H3 |
| InChIKey | DGKPPGCXDZCYAP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |