C27H36FN3O — CID 134032079
N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide (PubChem CID 134032079) has the molecular formula C27H36FN3O and a molecular weight of 437.60 g/mol. Its IUPAC name is N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 134032079 |
| Molecular Formula | C27H36FN3O |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | N-cyclohexyl-N-[(4-fluorophenyl)methyl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCc2ccccc2)CC1)N(Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H36FN3O/c28-25-13-11-24(12-14-25)21-31(26-9-5-2-6-10-26)27(32)22-30-19-17-29(18-20-30)16-15-23-7-3-1-4-8-23/h1,3-4,7-8,11-14,26H,2,5-6,9-10,15-22H2 |
| InChIKey | QJIOLIGDSCVLEW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |