C22H30FN3O3 — CID 7568278
N-cyclohexyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 7568278) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is N-cyclohexyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | N-cyclohexyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 7568278 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-cyclohexyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)N(Cc2ccc(F)cc2)C2CCCCC2)C1=O |
| InChI | InChI=1S/C22H30FN3O3/c1-3-22(4-2)20(28)26(21(29)24-22)15-19(27)25(18-8-6-5-7-9-18)14-16-10-12-17(23)13-11-16/h10-13,18H,3-9,14-15H2,1-2H3,(H,24,29) |
| InChIKey | MWRIQVHEVGUIAG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|