C20H23FN2O3 — CID 78813598
N-cyclopropyl-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 78813598) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is N-cyclopropyl-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | N-cyclopropyl-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 78813598 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-cyclopropyl-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C1C2CCCCC2C(=O)N1CC(=O)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C20H23FN2O3/c21-14-7-5-13(6-8-14)11-22(15-9-10-15)18(24)12-23-19(25)16-3-1-2-4-17(16)20(23)26/h5-8,15-17H,1-4,9-12H2 |
| InChIKey | DTSJSLLDQYTKJX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|