C19H22F2N2O4 — CID 51140706
N-[[4-(difluoromethoxy)phenyl]methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide (PubChem CID 51140706) has the molecular formula C19H22F2N2O4 and a molecular weight of 380.39 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 51140706 |
| Molecular Formula | C19H22F2N2O4 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H22F2N2O4/c1-22(10-12-6-8-13(9-7-12)27-19(20)21)16(24)11-23-17(25)14-4-2-3-5-15(14)18(23)26/h6-9,14-15,19H,2-5,10-11H2,1H3 |
| InChIKey | NXHSJTJWZYGJGE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|