C18H23F2NO2 — CID 78781581
2-(2-bicyclo[2.2.1]heptanyl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide (PubChem CID 78781581) has the molecular formula C18H23F2NO2 and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 78781581 |
| Molecular Formula | C18H23F2NO2 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C18H23F2NO2/c1-21(11-12-3-6-16(7-4-12)23-18(19)20)17(22)10-15-9-13-2-5-14(15)8-13/h3-4,6-7,13-15,18H,2,5,8-11H2,1H3 |
| InChIKey | LVTOOSCREAIXRA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |