C17H23F2NO2S2 — CID 55406974
N-[[4-(difluoromethoxy)phenyl]methyl]-5-(dithiolan-3-yl)-N-methylpentanamide (PubChem CID 55406974) has the molecular formula C17H23F2NO2S2 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-5-(dithiolan-3-yl)-N-methylpentanamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-5-(dithiolan-3-yl)-N-methylpentanamide |
|---|---|
| PubChem CID | 55406974 |
| Molecular Formula | C17H23F2NO2S2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-5-(dithiolan-3-yl)-N-methylpentanamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C17H23F2NO2S2/c1-20(12-13-6-8-14(9-7-13)22-17(18)19)16(21)5-3-2-4-15-10-11-23-24-15/h6-9,15,17H,2-5,10-12H2,1H3 |
| InChIKey | AVNLPIGCLGIAIH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|