C17H20F2N4O4 — CID 97248546
2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide (PubChem CID 97248546) has the molecular formula C17H20F2N4O4 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide.
| Compound Name | 2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 97248546 |
| Molecular Formula | C17H20F2N4O4 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[(8aS)-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazin-7-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylacetamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)CN1CCN2C(=O)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C17H20F2N4O4/c1-21(8-11-2-4-12(5-3-11)27-16(18)19)14(24)10-22-6-7-23-13(9-22)15(25)20-17(23)26/h2-5,13,16H,6-10H2,1H3,(H,20,25,26)/t13-/m0/s1 |
| InChIKey | MWUKILISCVLYMM-ZDUSSCGKSA-N |
| XLogP | 0.48 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|