C25H32FN3O2 — CID 18124761
3-[benzyl-[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl]amino]propanamide (PubChem CID 18124761) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-[benzyl-[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl]amino]propanamide.
| Compound Name | 3-[benzyl-[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 18124761 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 3-[benzyl-[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl]amino]propanamide |
| SMILES | NC(=O)CCN(CC(=O)N(Cc1ccc(F)cc1)C1CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C25H32FN3O2/c26-22-13-11-21(12-14-22)18-29(23-9-5-2-6-10-23)25(31)19-28(16-15-24(27)30)17-20-7-3-1-4-8-20/h1,3-4,7-8,11-14,23H,2,5-6,9-10,15-19H2,(H2,27,30) |
| InChIKey | ZTRZHZNLVJRALU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |