C16H22F2N2O2 — CID 110911083
N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]propanamide (PubChem CID 110911083) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]propanamide.
| Compound Name | N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 110911083 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[1-[2-(3,4-difluorophenyl)-2-hydroxyethyl]piperidin-3-yl]propanamide |
| SMILES | CCC(=O)NC1CCCN(CC(O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-2-16(22)19-12-4-3-7-20(9-12)10-15(21)11-5-6-13(17)14(18)8-11/h5-6,8,12,15,21H,2-4,7,9-10H2,1H3,(H,19,22) |
| InChIKey | QCSJQIKOAQGBSN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |