C16H22F2N2O — CID 46527777
N-cyclopentyl-2-[1-(3,4-difluorophenyl)ethyl-methylamino]acetamide (PubChem CID 46527777) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is N-cyclopentyl-2-[1-(3,4-difluorophenyl)ethyl-methylamino]acetamide.
| Compound Name | N-cyclopentyl-2-[1-(3,4-difluorophenyl)ethyl-methylamino]acetamide |
|---|---|
| PubChem CID | 46527777 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-cyclopentyl-2-[1-(3,4-difluorophenyl)ethyl-methylamino]acetamide |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)CC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H22F2N2O/c1-11(12-7-8-14(17)15(18)9-12)20(2)10-16(21)19-13-5-3-4-6-13/h7-9,11,13H,3-6,10H2,1-2H3,(H,19,21) |
| InChIKey | XEYHMIXSIRMPFK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |