C15H22F2N2 — CID 116906794
1-(3,4-difluorophenyl)-N,N-dimethyl-2-piperidin-2-ylethanamine (PubChem CID 116906794) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N,N-dimethyl-2-piperidin-2-ylethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-N,N-dimethyl-2-piperidin-2-ylethanamine |
|---|---|
| PubChem CID | 116906794 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N,N-dimethyl-2-piperidin-2-ylethanamine |
| SMILES | CN(C)C(CC1CCCCN1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2/c1-19(2)15(10-12-5-3-4-8-18-12)11-6-7-13(16)14(17)9-11/h6-7,9,12,15,18H,3-5,8,10H2,1-2H3 |
| InChIKey | HHJLVLAERWJMDO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |