C10H13F2NO — CID 54776114
2-(3,4-difluorophenyl)-2-(dimethylamino)ethanol (PubChem CID 54776114) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-(dimethylamino)ethanol.
| Compound Name | 2-(3,4-difluorophenyl)-2-(dimethylamino)ethanol |
|---|---|
| PubChem CID | 54776114 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-(dimethylamino)ethanol |
| SMILES | CN(C)C(CO)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H13F2NO/c1-13(2)10(6-14)7-3-4-8(11)9(12)5-7/h3-5,10,14H,6H2,1-2H3 |
| InChIKey | JFOGNXVZIDYXIH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |