C12H17IN2O — CID 134331148
2-(dimethylamino)-2-(2-iodo-1,3-dihydroisoindol-5-yl)ethanol (PubChem CID 134331148) has the molecular formula C12H17IN2O and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(2-iodo-1,3-dihydroisoindol-5-yl)ethanol.
| Compound Name | 2-(dimethylamino)-2-(2-iodo-1,3-dihydroisoindol-5-yl)ethanol |
|---|---|
| PubChem CID | 134331148 |
| Molecular Formula | C12H17IN2O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-(dimethylamino)-2-(2-iodo-1,3-dihydroisoindol-5-yl)ethanol |
| SMILES | CN(C)C(CO)c1ccc2c(c1)CN(I)C2 |
| InChI | InChI=1S/C12H17IN2O/c1-14(2)12(8-16)9-3-4-10-6-15(13)7-11(10)5-9/h3-5,12,16H,6-8H2,1-2H3 |
| InChIKey | DVOCPHBBOZCVGQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|