C12H16N2O2S — CID 116857284
6-[1-(dimethylamino)-2-hydroxyethyl]-4H-1,4-benzothiazin-3-one (PubChem CID 116857284) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 6-[1-(dimethylamino)-2-hydroxyethyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[1-(dimethylamino)-2-hydroxyethyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116857284 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 6-[1-(dimethylamino)-2-hydroxyethyl]-4H-1,4-benzothiazin-3-one |
| SMILES | CN(C)C(CO)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C12H16N2O2S/c1-14(2)10(6-15)8-3-4-11-9(5-8)13-12(16)7-17-11/h3-5,10,15H,6-7H2,1-2H3,(H,13,16) |
| InChIKey | YSPSJFYIDRVRCW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |