C10H12N2OS2 — CID 116830535
6-(1-amino-2-sulfanylethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 116830535) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-(1-amino-2-sulfanylethyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(1-amino-2-sulfanylethyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116830535 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 6-(1-amino-2-sulfanylethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | NC(CS)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C10H12N2OS2/c11-7(4-14)6-1-2-9-8(3-6)12-10(13)5-15-9/h1-3,7,14H,4-5,11H2,(H,12,13) |
| InChIKey | PWCSUFDNGITULT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|