C9H10N2OS2 — CID 116939513
6-[amino(sulfanyl)methyl]-4H-1,4-benzothiazin-3-one (PubChem CID 116939513) has the molecular formula C9H10N2OS2 and a molecular weight of 226.33 g/mol. Its IUPAC name is 6-[amino(sulfanyl)methyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[amino(sulfanyl)methyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116939513 |
| Molecular Formula | C9H10N2OS2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 6-[amino(sulfanyl)methyl]-4H-1,4-benzothiazin-3-one |
| SMILES | NC(S)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C9H10N2OS2/c10-9(13)5-1-2-7-6(3-5)11-8(12)4-14-7/h1-3,9,13H,4,10H2,(H,11,12) |
| InChIKey | PIXZESTVSXDOLY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|