C10H10N2O3S — CID 116994382
2-amino-2-(3-oxo-4H-1,4-benzothiazin-7-yl)acetic acid (PubChem CID 116994382) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-amino-2-(3-oxo-4H-1,4-benzothiazin-7-yl)acetic acid.
| Compound Name | 2-amino-2-(3-oxo-4H-1,4-benzothiazin-7-yl)acetic acid |
|---|---|
| PubChem CID | 116994382 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-amino-2-(3-oxo-4H-1,4-benzothiazin-7-yl)acetic acid |
| SMILES | NC(C(=O)O)c1ccc2c(c1)SCC(=O)N2 |
| InChI | InChI=1S/C10H10N2O3S/c11-9(10(14)15)5-1-2-6-7(3-5)16-4-8(13)12-6/h1-3,9H,4,11H2,(H,12,13)(H,14,15) |
| InChIKey | AOPNGWKFOZNLPO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |