C13H19N3OS — CID 116934368
6-(1,4-diaminopentyl)-4H-1,4-benzothiazin-3-one (PubChem CID 116934368) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 6-(1,4-diaminopentyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(1,4-diaminopentyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116934368 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 6-(1,4-diaminopentyl)-4H-1,4-benzothiazin-3-one |
| SMILES | CC(N)CCC(N)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C13H19N3OS/c1-8(14)2-4-10(15)9-3-5-12-11(6-9)16-13(17)7-18-12/h3,5-6,8,10H,2,4,7,14-15H2,1H3,(H,16,17) |
| InChIKey | PCMYXQQBILEUHY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |