C9H12N4OS — CID 116947486
6-[amino(hydrazinyl)methyl]-4H-1,4-benzothiazin-3-one (PubChem CID 116947486) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 6-[amino(hydrazinyl)methyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[amino(hydrazinyl)methyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116947486 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 6-[amino(hydrazinyl)methyl]-4H-1,4-benzothiazin-3-one |
| SMILES | NNC(N)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C9H12N4OS/c10-9(13-11)5-1-2-7-6(3-5)12-8(14)4-15-7/h1-3,9,13H,4,10-11H2,(H,12,14) |
| InChIKey | OENMFBDCEDKESC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|