C10H14N4OS — CID 115260659
6-[hydrazinylmethyl(methyl)amino]-4H-1,4-benzothiazin-3-one (PubChem CID 115260659) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 6-[hydrazinylmethyl(methyl)amino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-[hydrazinylmethyl(methyl)amino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115260659 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-[hydrazinylmethyl(methyl)amino]-4H-1,4-benzothiazin-3-one |
| SMILES | CN(CNN)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C10H14N4OS/c1-14(6-12-11)7-2-3-9-8(4-7)13-10(15)5-16-9/h2-4,12H,5-6,11H2,1H3,(H,13,15) |
| InChIKey | ZPWAQWNDVVQKKQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|