C13H23N3 — CID 116906796
N,N-dimethyl-2-piperidin-2-yl-1-(1H-pyrrol-2-yl)ethanamine (PubChem CID 116906796) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N,N-dimethyl-2-piperidin-2-yl-1-(1H-pyrrol-2-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-piperidin-2-yl-1-(1H-pyrrol-2-yl)ethanamine |
|---|---|
| PubChem CID | 116906796 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N,N-dimethyl-2-piperidin-2-yl-1-(1H-pyrrol-2-yl)ethanamine |
| SMILES | CN(C)C(CC1CCCCN1)c1ccc[nH]1 |
| InChI | InChI=1S/C13H23N3/c1-16(2)13(12-7-5-9-15-12)10-11-6-3-4-8-14-11/h5,7,9,11,13-15H,3-4,6,8,10H2,1-2H3 |
| InChIKey | NRMXFEMRHGCXIE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |