C16H24F2N2 — CID 79548685
N-[1-(3,4-difluorophenyl)ethyl]-1-piperidin-2-ylpropan-2-amine (PubChem CID 79548685) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-1-piperidin-2-ylpropan-2-amine.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-1-piperidin-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 79548685 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-1-piperidin-2-ylpropan-2-amine |
| SMILES | CC(CC1CCCCN1)NC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H24F2N2/c1-11(9-14-5-3-4-8-19-14)20-12(2)13-6-7-15(17)16(18)10-13/h6-7,10-12,14,19-20H,3-5,8-9H2,1-2H3 |
| InChIKey | VWNFSLIBHXVRKD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |