C17H25FN2O3 — CID 111564968
ethyl N-[1-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate (PubChem CID 111564968) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is ethyl N-[1-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111564968 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | ethyl N-[1-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(CC(O)c2ccc(F)cc2C)C1 |
| InChI | InChI=1S/C17H25FN2O3/c1-3-23-17(22)19-14-5-4-8-20(10-14)11-16(21)15-7-6-13(18)9-12(15)2/h6-7,9,14,16,21H,3-5,8,10-11H2,1-2H3,(H,19,22) |
| InChIKey | ZGLGNJMNQZCYLD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |