C20H31FN2O — CID 111565154
1-(4-fluoro-2-methylphenyl)-2-[4-(4-methylcyclohexyl)piperazin-1-yl]ethanol (PubChem CID 111565154) has the molecular formula C20H31FN2O and a molecular weight of 334.48 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-2-[4-(4-methylcyclohexyl)piperazin-1-yl]ethanol.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-2-[4-(4-methylcyclohexyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 111565154 |
| Molecular Formula | C20H31FN2O |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-2-[4-(4-methylcyclohexyl)piperazin-1-yl]ethanol |
| SMILES | Cc1cc(F)ccc1C(O)CN1CCN(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C20H31FN2O/c1-15-3-6-18(7-4-15)23-11-9-22(10-12-23)14-20(24)19-8-5-17(21)13-16(19)2/h5,8,13,15,18,20,24H,3-4,6-7,9-12,14H2,1-2H3 |
| InChIKey | YZESADKPUFBDTK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |