C17H26FN3O2 — CID 111564930
N-ethyl-2-[4-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperazin-1-yl]acetamide (PubChem CID 111564930) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is N-ethyl-2-[4-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperazin-1-yl]acetamide.
| Compound Name | N-ethyl-2-[4-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 111564930 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-ethyl-2-[4-[2-(4-fluoro-2-methylphenyl)-2-hydroxyethyl]piperazin-1-yl]acetamide |
| SMILES | CCNC(=O)CN1CCN(CC(O)c2ccc(F)cc2C)CC1 |
| InChI | InChI=1S/C17H26FN3O2/c1-3-19-17(23)12-21-8-6-20(7-9-21)11-16(22)15-5-4-14(18)10-13(15)2/h4-5,10,16,22H,3,6-9,11-12H2,1-2H3,(H,19,23) |
| InChIKey | NUYIVZPMYQECFR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |