C17H24F2N2O — CID 110898547
1-(2,4-difluorophenyl)-2-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanol (PubChem CID 110898547) has the molecular formula C17H24F2N2O and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanol |
|---|---|
| PubChem CID | 110898547 |
| Molecular Formula | C17H24F2N2O |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(4-pyrrolidin-1-ylpiperidin-1-yl)ethanol |
| SMILES | OC(CN1CCC(N2CCCC2)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H24F2N2O/c18-13-3-4-15(16(19)11-13)17(22)12-20-9-5-14(6-10-20)21-7-1-2-8-21/h3-4,11,14,17,22H,1-2,5-10,12H2 |
| InChIKey | NUCPDIIUQOGMCZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |